C21H16N4O5 — CID 3777798
4-methoxy-N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-nitrobenzamide (PubChem CID 3777798) has the molecular formula C21H16N4O5 and a molecular weight of 404.38 g/mol. Its IUPAC name is 4-methoxy-N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-methoxy-N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3777798 |
| Molecular Formula | C21H16N4O5 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-methoxy-N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3nc4ncccc4o3)cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N4O5/c1-12-10-14(21-24-19-18(30-21)4-3-9-22-19)5-7-15(12)23-20(26)13-6-8-17(29-2)16(11-13)25(27)28/h3-11H,1-2H3,(H,23,26) |
| InChIKey | GOQQWRWPNBFRPA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|