C21H15N5O4S — CID 22779835
N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 22779835) has the molecular formula C21H15N5O4S and a molecular weight of 433.45 g/mol. Its IUPAC name is N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 22779835 |
| Molecular Formula | C21H15N5O4S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | Cc1cc(-c2nc3ncccc3o2)ccc1NC(=S)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15N5O4S/c1-12-10-14(20-24-18-17(30-20)6-3-9-22-18)7-8-16(12)23-21(31)25-19(27)13-4-2-5-15(11-13)26(28)29/h2-11H,1H3,(H2,23,25,27,31) |
| InChIKey | AHKINNZNKPFWDA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|