C20H13ClN4O5 — CID 2980391
N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-methoxy-3-nitrobenzamide (PubChem CID 2980391) has the molecular formula C20H13ClN4O5 and a molecular weight of 424.80 g/mol. Its IUPAC name is N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 2980391 |
| Molecular Formula | C20H13ClN4O5 |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3nc4ncccc4o3)ccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13ClN4O5/c1-29-16-7-5-11(10-15(16)25(27)28)19(26)23-14-9-12(4-6-13(14)21)20-24-18-17(30-20)3-2-8-22-18/h2-10H,1H3,(H,23,26) |
| InChIKey | ITPLBAKLVISLTM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|