C32H29N3O3S — CID 17316469
N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide (PubChem CID 17316469) has the molecular formula C32H29N3O3S and a molecular weight of 535.67 g/mol. Its IUPAC name is N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17316469 |
| Molecular Formula | C32H29N3O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(-c2nc3cc(C(C)C)ccc3o2)cc1NC(=S)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29N3O3S/c1-20(2)23-14-17-28-26(18-23)33-31(38-28)24-15-16-27(37-3)25(19-24)34-32(39)35-30(36)29(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-20,29H,1-3H3,(H2,34,35,36,39) |
| InChIKey | JDJYXJHZVPKOFZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|