C29H23Cl2N3O4S — CID 17316475
5-(2,5-dichlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17316475) has the molecular formula C29H23Cl2N3O4S and a molecular weight of 580.49 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17316475 |
| Molecular Formula | C29H23Cl2N3O4S |
| Molecular Weight | 580.49 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | COc1ccc(-c2nc3cc(C(C)C)ccc3o2)cc1NC(=S)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C29H23Cl2N3O4S/c1-15(2)16-4-9-25-22(12-16)32-28(38-25)17-5-8-24(36-3)21(13-17)33-29(39)34-27(35)26-11-10-23(37-26)19-14-18(30)6-7-20(19)31/h4-15H,1-3H3,(H2,33,34,35,39) |
| InChIKey | HFUHAGXDNDYOHA-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.49 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|