C23H17Cl2N3O3S — CID 2284680
5-chloro-N-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 2284680) has the molecular formula C23H17Cl2N3O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is 5-chloro-N-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 2284680 |
| Molecular Formula | C23H17Cl2N3O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 5-chloro-N-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(=S)Nc1cc(-c2nc3cc(C)ccc3o2)ccc1Cl |
| InChI | InChI=1S/C23H17Cl2N3O3S/c1-12-3-7-20-18(9-12)26-22(31-20)13-4-6-16(25)17(10-13)27-23(32)28-21(29)15-11-14(24)5-8-19(15)30-2/h3-11H,1-2H3,(H2,27,28,29,32) |
| InChIKey | KUNSQBYNXFXNIZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|