C28H21ClN4O5S — CID 17314382
N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 17314382) has the molecular formula C28H21ClN4O5S and a molecular weight of 561.02 g/mol. Its IUPAC name is N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17314382 |
| Molecular Formula | C28H21ClN4O5S |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | CC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4ccc(-c5ccccc5[N+](=O)[O-])o4)c3)nc2c1 |
| InChI | InChI=1S/C28H21ClN4O5S/c1-15(2)16-8-10-24-21(13-16)30-27(38-24)17-7-9-19(29)20(14-17)31-28(39)32-26(34)25-12-11-23(37-25)18-5-3-4-6-22(18)33(35)36/h3-15H,1-2H3,(H2,31,32,34,39) |
| InChIKey | AVIVKGVYSOXTSZ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|