C25H16ClN3O5 — CID 1423465
N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 1423465) has the molecular formula C25H16ClN3O5 and a molecular weight of 473.87 g/mol. Its IUPAC name is N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1423465 |
| Molecular Formula | C25H16ClN3O5 |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1ccc2oc(-c3ccc(Cl)c(NC(=O)c4ccc(-c5ccccc5[N+](=O)[O-])o4)c3)nc2c1 |
| InChI | InChI=1S/C25H16ClN3O5/c1-14-6-9-22-19(12-14)28-25(34-22)15-7-8-17(26)18(13-15)27-24(30)23-11-10-21(33-23)16-4-2-3-5-20(16)29(31)32/h2-13H,1H3,(H,27,30) |
| InChIKey | GVHXZVDHSBDOGW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|