C26H19N3O5 — CID 1348898
N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 1348898) has the molecular formula C26H19N3O5 and a molecular weight of 453.45 g/mol. Its IUPAC name is N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1348898 |
| Molecular Formula | C26H19N3O5 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | CCc1ccc2oc(-c3ccc(NC(=O)c4ccc(-c5ccccc5[N+](=O)[O-])o4)cc3)nc2c1 |
| InChI | InChI=1S/C26H19N3O5/c1-2-16-7-12-23-20(15-16)28-26(34-23)17-8-10-18(11-9-17)27-25(30)24-14-13-22(33-24)19-5-3-4-6-21(19)29(31)32/h3-15H,2H2,1H3,(H,27,30) |
| InChIKey | OHZMFOQCDJRQAW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|