C24H16N4O4 — CID 4568237
N-[4-(1H-benzimidazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 4568237) has the molecular formula C24H16N4O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4568237 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C24H16N4O4/c29-24(22-14-13-21(32-22)17-5-1-4-8-20(17)28(30)31)25-16-11-9-15(10-12-16)23-26-18-6-2-3-7-19(18)27-23/h1-14H,(H,25,29)(H,26,27) |
| InChIKey | AOSQWDLFMNKWIC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|