C40H26N8O6 — CID 135928290
2-nitro-N-[4-[5-[2-[4-[(2-nitrobenzoyl)amino]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenyl]benzamide (PubChem CID 135928290) has the molecular formula C40H26N8O6 and a molecular weight of 714.70 g/mol. Its IUPAC name is 2-nitro-N-[4-[5-[2-[4-[(2-nitrobenzoyl)amino]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenyl]benzamide.
| Compound Name | 2-nitro-N-[4-[5-[2-[4-[(2-nitrobenzoyl)amino]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 135928290 |
| Molecular Formula | C40H26N8O6 |
| Molecular Weight | 714.70 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | 2-nitro-N-[4-[5-[2-[4-[(2-nitrobenzoyl)amino]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3cc(-c4ccc5nc(-c6ccc(NC(=O)c7ccccc7[N+](=O)[O-])cc6)[nH]c5c4)ccc3[nH]2)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C40H26N8O6/c49-39(29-5-1-3-7-35(29)47(51)52)41-27-15-9-23(10-16-27)37-43-31-19-13-25(21-33(31)45-37)26-14-20-32-34(22-26)46-38(44-32)24-11-17-28(18-12-24)42-40(50)30-6-2-4-8-36(30)48(53)54/h1-22H,(H,41,49)(H,42,50)(H,43,45)(H,44,46) |
| InChIKey | XAZPHBWQVJWRMD-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 201.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.70 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|