C21H15N5O3 — CID 110527226
N-[(E)-(2-nitrophenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide (PubChem CID 110527226) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[(E)-(2-nitrophenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(E)-(2-nitrophenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110527226 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[(E)-(2-nitrophenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1[N+](=O)[O-])c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C21H15N5O3/c27-21(25-22-13-16-8-4-5-9-19(16)26(28)29)15-10-11-17-18(12-15)24-20(23-17)14-6-2-1-3-7-14/h1-13H,(H,23,24)(H,25,27)/b22-13+ |
| InChIKey | ULGZEFXYKULHTM-LPYMAVHISA-N |
| XLogP | 3.90 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|