C22H18N4O3 — CID 170838403
N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide (PubChem CID 170838403) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 170838403 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenyl-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2ccc3nc(-c4ccccc4)[nH]c3c2)cc1O |
| InChI | InChI=1S/C22H18N4O3/c1-29-20-10-7-14(11-19(20)27)13-23-26-22(28)16-8-9-17-18(12-16)25-21(24-17)15-5-3-2-4-6-15/h2-13,27H,1H3,(H,24,25)(H,26,28) |
| InChIKey | RMKXUAIBHQVPRM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|