C23H20N4O4 — CID 136781359
N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 136781359) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 136781359 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc3nc(-c4ccccc4O)[nH]c3c2)c(OC)c1 |
| InChI | InChI=1S/C23H20N4O4/c1-30-16-9-7-15(21(12-16)31-2)13-24-27-23(29)14-8-10-18-19(11-14)26-22(25-18)17-5-3-4-6-20(17)28/h3-13,28H,1-2H3,(H,25,26)(H,27,29)/b24-13+ |
| InChIKey | ODANXKASRKNAMT-ZMOGYAJESA-N |
| XLogP | 3.72 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|