C24H22N4O5 — CID 136781361
2-(2-hydroxyphenyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 136781361) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(2-hydroxyphenyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 136781361 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-(2-hydroxyphenyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc3nc(-c4ccccc4O)[nH]c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N4O5/c1-31-20-10-14(11-21(32-2)22(20)33-3)13-25-28-24(30)15-8-9-17-18(12-15)27-23(26-17)16-6-4-5-7-19(16)29/h4-13,29H,1-3H3,(H,26,27)(H,28,30)/b25-13+ |
| InChIKey | IICMQRGMOWJCNS-DHRITJCHSA-N |
| XLogP | 3.73 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|