C25H18N4O3 — CID 136781294
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 136781294) has the molecular formula C25H18N4O3 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 136781294 |
| Molecular Formula | C25H18N4O3 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(2-hydroxyphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)c1ccc2nc(-c3ccccc3O)[nH]c2c1 |
| InChI | InChI=1S/C25H18N4O3/c30-22-8-4-3-7-18(22)24-27-20-11-9-16(13-21(20)28-24)25(32)29-26-14-19-17-6-2-1-5-15(17)10-12-23(19)31/h1-14,30-31H,(H,27,28)(H,29,32)/b26-14+ |
| InChIKey | SIQVWNQZUKIDEC-VULFUBBASA-N |
| XLogP | 4.56 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|