C24H21ClN4O4 — CID 170838447
2-(4-chlorophenyl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 170838447) has the molecular formula C24H21ClN4O4 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 170838447 |
| Molecular Formula | C24H21ClN4O4 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc3nc(-c4ccc(Cl)cc4)[nH]c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H21ClN4O4/c1-31-20-10-14(11-21(32-2)22(20)33-3)13-26-29-24(30)16-6-9-18-19(12-16)28-23(27-18)15-4-7-17(25)8-5-15/h4-13H,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | WWSYMIDXOFNHOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|