C20H14N4O2 — CID 4067599
1-(2-nitrophenyl)-N-(2-phenyl-3H-benzimidazol-5-yl)methanimine (PubChem CID 4067599) has the molecular formula C20H14N4O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-(2-phenyl-3H-benzimidazol-5-yl)methanimine.
| Compound Name | 1-(2-nitrophenyl)-N-(2-phenyl-3H-benzimidazol-5-yl)methanimine |
|---|---|
| PubChem CID | 4067599 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-(2-nitrophenyl)-N-(2-phenyl-3H-benzimidazol-5-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccccc1/C=N/c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C20H14N4O2/c25-24(26)19-9-5-4-8-15(19)13-21-16-10-11-17-18(12-16)23-20(22-17)14-6-2-1-3-7-14/h1-13H,(H,22,23)/b21-13+ |
| InChIKey | XNBRVUTYIQYWPX-FYJGNVAPSA-N |
| XLogP | 4.89 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|