C27H16N8O10 — CID 135412392
2-[[4-[6-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1H-benzimidazol-2-yl]phenyl]iminomethyl]-4,6-dinitrophenol (PubChem CID 135412392) has the molecular formula C27H16N8O10 and a molecular weight of 612.47 g/mol. Its IUPAC name is 2-[[4-[6-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1H-benzimidazol-2-yl]phenyl]iminomethyl]-4,6-dinitrophenol.
| Compound Name | 2-[[4-[6-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1H-benzimidazol-2-yl]phenyl]iminomethyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 135412392 |
| Molecular Formula | C27H16N8O10 |
| Molecular Weight | 612.47 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 2-[[4-[6-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1H-benzimidazol-2-yl]phenyl]iminomethyl]-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(/C=N/c2ccc(-c3nc4ccc(/N=C/c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5O)cc4[nH]3)cc2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H16N8O10/c36-25-15(7-19(32(38)39)10-23(25)34(42)43)12-28-17-3-1-14(2-4-17)27-30-21-6-5-18(9-22(21)31-27)29-13-16-8-20(33(40)41)11-24(26(16)37)35(44)45/h1-13,36-37H,(H,30,31)/b28-12+,29-13+ |
| InChIKey | RAAYKWOPKGELNO-UUYAOZHUSA-N |
| XLogP | 5.78 |
| TPSA | 266.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|