C14H9N5O6 — CID 3291118
5-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 3291118) has the molecular formula C14H9N5O6 and a molecular weight of 343.26 g/mol. Its IUPAC name is 5-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 3291118 |
| Molecular Formula | C14H9N5O6 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 5-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(/N=C/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)cc2[nH]1 |
| InChI | InChI=1S/C14H9N5O6/c20-13-7(3-9(18(22)23)5-12(13)19(24)25)6-15-8-1-2-10-11(4-8)17-14(21)16-10/h1-6,20H,(H2,16,17,21)/b15-6+ |
| InChIKey | IGRVGPGVBYBJOJ-GIDUJCDVSA-N |
| XLogP | 2.13 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|