C20H13ClN4O6 — CID 135799783
3-chloro-N-[3-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]phenyl]benzamide (PubChem CID 135799783) has the molecular formula C20H13ClN4O6 and a molecular weight of 440.80 g/mol. Its IUPAC name is 3-chloro-N-[3-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]phenyl]benzamide.
| Compound Name | 3-chloro-N-[3-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]phenyl]benzamide |
|---|---|
| PubChem CID | 135799783 |
| Molecular Formula | C20H13ClN4O6 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-chloro-N-[3-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(/N=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H13ClN4O6/c21-14-4-1-3-12(7-14)20(27)23-16-6-2-5-15(9-16)22-11-13-8-17(24(28)29)10-18(19(13)26)25(30)31/h1-11,26H,(H,23,27)/b22-11+ |
| InChIKey | VZUWPACJLYBERS-SSDVNMTOSA-N |
| XLogP | 4.86 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|