C22H17ClN4O5 — CID 136868853
N-[3-[[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide (PubChem CID 136868853) has the molecular formula C22H17ClN4O5 and a molecular weight of 452.85 g/mol. Its IUPAC name is N-[3-[[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[3-[[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 136868853 |
| Molecular Formula | C22H17ClN4O5 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[3-[[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc(C(=O)N/N=C\c3cc(Cl)cc([N+](=O)[O-])c3O)c2)c1 |
| InChI | InChI=1S/C22H17ClN4O5/c1-13-4-2-5-14(8-13)21(29)25-18-7-3-6-15(10-18)22(30)26-24-12-16-9-17(23)11-19(20(16)28)27(31)32/h2-12,28H,1H3,(H,25,29)(H,26,30)/b24-12- |
| InChIKey | SBGGVKXHGHXJFS-MSXFZWOLSA-N |
| XLogP | 4.28 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|