C18H19ClN4O6S — CID 5186191
N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide (PubChem CID 5186191) has the molecular formula C18H19ClN4O6S and a molecular weight of 454.89 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 5186191 |
| Molecular Formula | C18H19ClN4O6S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NN=Cc2cc(Cl)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C18H19ClN4O6S/c1-3-22(4-2)30(28,29)15-7-5-6-12(9-15)18(25)21-20-11-13-8-14(19)10-16(17(13)24)23(26)27/h5-11,24H,3-4H2,1-2H3,(H,21,25) |
| InChIKey | SMTLDYYEEJSAPD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|