C22H19ClN4O7S — CID 135562401
N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide (PubChem CID 135562401) has the molecular formula C22H19ClN4O7S and a molecular weight of 518.94 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 135562401 |
| Molecular Formula | C22H19ClN4O7S |
| Molecular Weight | 518.94 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccccc2C(=O)N/N=C\c2cc(Cl)cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C22H19ClN4O7S/c1-2-34-16-7-9-17(10-8-16)35(32,33)26-19-6-4-3-5-18(19)22(29)25-24-13-14-11-15(23)12-20(21(14)28)27(30)31/h3-13,26,28H,2H2,1H3,(H,25,29)/b24-13- |
| InChIKey | RHVOINFMJOSYDU-CFRMEGHHSA-N |
| XLogP | 3.92 |
| TPSA | 160.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|