C31H29N3O7S — CID 5019268
methyl 4-[[2-[[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 5019268) has the molecular formula C31H29N3O7S and a molecular weight of 587.65 g/mol. Its IUPAC name is methyl 4-[[2-[[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 5019268 |
| Molecular Formula | C31H29N3O7S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | methyl 4-[[2-[[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccccc2C(=O)NN=Cc2ccccc2OCc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C31H29N3O7S/c1-3-40-25-16-18-26(19-17-25)42(37,38)34-28-10-6-5-9-27(28)30(35)33-32-20-24-8-4-7-11-29(24)41-21-22-12-14-23(15-13-22)31(36)39-2/h4-20,34H,3,21H2,1-2H3,(H,33,35) |
| InChIKey | DYFZVYFZZGXYMP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|