C28H24BrN3O4S — CID 4153906
N-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 4153906) has the molecular formula C28H24BrN3O4S and a molecular weight of 578.49 g/mol. Its IUPAC name is N-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 4153906 |
| Molecular Formula | C28H24BrN3O4S |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | N-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NN=Cc3ccccc3OCc3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H24BrN3O4S/c1-20-6-16-26(17-7-20)37(34,35)32-25-14-10-22(11-15-25)28(33)31-30-18-23-4-2-3-5-27(23)36-19-21-8-12-24(29)13-9-21/h2-18,32H,19H2,1H3,(H,31,33) |
| InChIKey | LAIVOHVFWWXWEJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|