C28H25N3O4S — CID 6024079
4-[(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 6024079) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6024079 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-[(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)N/N=C\c3cccc(OCc4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C28H25N3O4S/c1-21-10-16-27(17-11-21)36(33,34)31-25-14-12-24(13-15-25)28(32)30-29-19-23-8-5-9-26(18-23)35-20-22-6-3-2-4-7-22/h2-19,31H,20H2,1H3,(H,30,32)/b29-19- |
| InChIKey | SQOZPMFQSDGNIY-CEUNXORHSA-N |
| XLogP | 5.14 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|