C29H25N3O6S — CID 51061566
[3-[(E)-[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 51061566) has the molecular formula C29H25N3O6S and a molecular weight of 543.60 g/mol. Its IUPAC name is [3-[(E)-[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [3-[(E)-[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 51061566 |
| Molecular Formula | C29H25N3O6S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | [3-[(E)-[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(/C=N/NC(=O)c3ccc(NS(=O)(=O)c4ccc(C)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C29H25N3O6S/c1-20-6-16-27(17-7-20)39(35,36)32-24-12-8-22(9-13-24)28(33)31-30-19-21-4-3-5-26(18-21)38-29(34)23-10-14-25(37-2)15-11-23/h3-19,32H,1-2H3,(H,31,33)/b30-19+ |
| InChIKey | LRZIQXQAINMGRX-NDZAJKAJSA-N |
| XLogP | 4.79 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|