C27H21N3O5S — CID 6047938
[4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 6047938) has the molecular formula C27H21N3O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is [4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6047938 |
| Molecular Formula | C27H21N3O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | [4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(N/N=C\c1ccc(OC(=O)c2ccccc2)cc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N3O5S/c31-26(21-13-15-23(16-14-21)30-36(33,34)25-9-5-2-6-10-25)29-28-19-20-11-17-24(18-12-20)35-27(32)22-7-3-1-4-8-22/h1-19,30H,(H,29,31)/b28-19- |
| InChIKey | BOQIPTWQEUFTKW-USHMODERSA-N |
| XLogP | 4.47 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|