C27H20IN3O5S — CID 4150709
[4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 4150709) has the molecular formula C27H20IN3O5S and a molecular weight of 625.44 g/mol. Its IUPAC name is [4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 4150709 |
| Molecular Formula | C27H20IN3O5S |
| Molecular Weight | 625.44 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | [4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2ccccc2I)cc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20IN3O5S/c28-25-9-5-4-8-24(25)27(33)36-22-16-10-19(11-17-22)18-29-30-26(32)20-12-14-21(15-13-20)31-37(34,35)23-6-2-1-3-7-23/h1-18,31H,(H,30,32) |
| InChIKey | HYSUDRJODRPNBM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|