C21H15BrF3N3O3S — CID 6904569
4-[(4-bromophenyl)sulfonylamino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 6904569) has the molecular formula C21H15BrF3N3O3S and a molecular weight of 526.33 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonylamino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(4-bromophenyl)sulfonylamino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6904569 |
| Molecular Formula | C21H15BrF3N3O3S |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonylamino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccccc1C(F)(F)F)c1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H15BrF3N3O3S/c22-16-7-11-18(12-8-16)32(30,31)28-17-9-5-14(6-10-17)20(29)27-26-13-15-3-1-2-4-19(15)21(23,24)25/h1-13,28H,(H,27,29)/b26-13+ |
| InChIKey | LAEPQURHKBUUBM-LGJNPRDNSA-N |
| XLogP | 5.03 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|