C20H15Cl2N3O3S — CID 4119667
4-(benzenesulfonamido)-N-[(2,3-dichlorophenyl)methylideneamino]benzamide (PubChem CID 4119667) has the molecular formula C20H15Cl2N3O3S and a molecular weight of 448.33 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(2,3-dichlorophenyl)methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(2,3-dichlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4119667 |
| Molecular Formula | C20H15Cl2N3O3S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(2,3-dichlorophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cccc(Cl)c1Cl)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O3S/c21-18-8-4-5-15(19(18)22)13-23-24-20(26)14-9-11-16(12-10-14)25-29(27,28)17-6-2-1-3-7-17/h1-13,25H,(H,24,26) |
| InChIKey | GPBQPUYZUYHMFX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|