C22H18N4O3S — CID 3484834
4-(benzenesulfonamido)-N-(1H-indol-3-ylmethylideneamino)benzamide (PubChem CID 3484834) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(1H-indol-3-ylmethylideneamino)benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-(1H-indol-3-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 3484834 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(1H-indol-3-ylmethylideneamino)benzamide |
| SMILES | O=C(NN=Cc1c[nH]c2ccccc12)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N4O3S/c27-22(25-24-15-17-14-23-21-9-5-4-8-20(17)21)16-10-12-18(13-11-16)26-30(28,29)19-6-2-1-3-7-19/h1-15,23,26H,(H,25,27) |
| InChIKey | JWARWQXOPFOWDW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|