C24H20N4O3 — CID 3694322
4-(2-anilino-2-oxoethoxy)-N-(1H-indol-3-ylmethylideneamino)benzamide (PubChem CID 3694322) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-(2-anilino-2-oxoethoxy)-N-(1H-indol-3-ylmethylideneamino)benzamide.
| Compound Name | 4-(2-anilino-2-oxoethoxy)-N-(1H-indol-3-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 3694322 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-(2-anilino-2-oxoethoxy)-N-(1H-indol-3-ylmethylideneamino)benzamide |
| SMILES | O=C(COc1ccc(C(=O)NN=Cc2c[nH]c3ccccc23)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C24H20N4O3/c29-23(27-19-6-2-1-3-7-19)16-31-20-12-10-17(11-13-20)24(30)28-26-15-18-14-25-22-9-5-4-8-21(18)22/h1-15,25H,16H2,(H,27,29)(H,28,30) |
| InChIKey | CELUJHXTBQRHKN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|