C27H22N6O3 — CID 135704652
N-[(E)-1H-indol-3-ylmethylideneamino]-4-[2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide (PubChem CID 135704652) has the molecular formula C27H22N6O3 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-4-[2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4-[2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 135704652 |
| Molecular Formula | C27H22N6O3 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4-[2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1ccc(C(=O)N/N=C/c2c[nH]c3ccccc23)cc1)N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H22N6O3/c34-26(32-30-15-19-13-28-24-7-3-1-5-22(19)24)17-36-21-11-9-18(10-12-21)27(35)33-31-16-20-14-29-25-8-4-2-6-23(20)25/h1-16,28-29H,17H2,(H,32,34)(H,33,35)/b30-15+,31-16+ |
| InChIKey | JSBWVEJQUDPPAV-KUGLDEIXSA-N |
| XLogP | 3.94 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|