C27H36N4O3 — CID 135719350
4-[2-hydroxy-3-(2,4,4-trimethylpentan-2-ylamino)propoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]benzamide (PubChem CID 135719350) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(2,4,4-trimethylpentan-2-ylamino)propoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]benzamide.
| Compound Name | 4-[2-hydroxy-3-(2,4,4-trimethylpentan-2-ylamino)propoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 135719350 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 4-[2-hydroxy-3-(2,4,4-trimethylpentan-2-ylamino)propoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]benzamide |
| SMILES | CC(C)(C)CC(C)(C)NCC(O)COc1ccc(C(=O)N/N=C/c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H36N4O3/c1-26(2,3)18-27(4,5)29-16-21(32)17-34-22-12-10-19(11-13-22)25(33)31-30-15-20-14-28-24-9-7-6-8-23(20)24/h6-15,21,28-29,32H,16-18H2,1-5H3,(H,31,33)/b30-15+ |
| InChIKey | HRMDJMKTVWVPQG-FJEPWZHXSA-N |
| XLogP | 4.48 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|