C21H22N4O2 — CID 135678489
N-[(E)-1H-indol-3-ylmethylideneamino]-4-(pentanoylamino)benzamide (PubChem CID 135678489) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-4-(pentanoylamino)benzamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4-(pentanoylamino)benzamide |
|---|---|
| PubChem CID | 135678489 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4-(pentanoylamino)benzamide |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)N/N=C/c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C21H22N4O2/c1-2-3-8-20(26)24-17-11-9-15(10-12-17)21(27)25-23-14-16-13-22-19-7-5-4-6-18(16)19/h4-7,9-14,22H,2-3,8H2,1H3,(H,24,26)(H,25,27)/b23-14+ |
| InChIKey | QBOVSENKINLMHG-OEAKJJBVSA-N |
| XLogP | 4.06 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|