C22H17BrN4O5S — CID 6113236
4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide (PubChem CID 6113236) has the molecular formula C22H17BrN4O5S and a molecular weight of 529.37 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide.
| Compound Name | 4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide |
|---|---|
| PubChem CID | 6113236 |
| Molecular Formula | C22H17BrN4O5S |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 528.01 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide |
| SMILES | O=C(N/N=C\C=C\c1ccccc1[N+](=O)[O-])c1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H17BrN4O5S/c23-18-9-13-20(14-10-18)33(31,32)26-19-11-7-17(8-12-19)22(28)25-24-15-3-5-16-4-1-2-6-21(16)27(29)30/h1-15,26H,(H,25,28)/b5-3+,24-15- |
| InChIKey | BMBIFQVOJSJZDQ-HKVMTXNBSA-N |
| XLogP | 4.59 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|