C14H11N5O3 — CID 6506022
N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyrazine-2-carboxamide (PubChem CID 6506022) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyrazine-2-carboxamide.
| Compound Name | N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 6506022 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyrazine-2-carboxamide |
| SMILES | O=C(N/N=C\C=C/c1ccccc1[N+](=O)[O-])c1cnccn1 |
| InChI | InChI=1S/C14H11N5O3/c20-14(12-10-15-8-9-16-12)18-17-7-3-5-11-4-1-2-6-13(11)19(21)22/h1-10H,(H,18,20)/b5-3-,17-7- |
| InChIKey | LPHKLEXVOYDEMO-CWCJHYOQSA-N |
| XLogP | 1.81 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|