C14H11BrN4O3 — CID 8982753
4-bromo-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrrole-2-carboxamide (PubChem CID 8982753) has the molecular formula C14H11BrN4O3 and a molecular weight of 363.17 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8982753 |
| Molecular Formula | C14H11BrN4O3 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 4-bromo-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(N/N=C\C=C\c1ccccc1[N+](=O)[O-])c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C14H11BrN4O3/c15-11-8-12(16-9-11)14(20)18-17-7-3-5-10-4-1-2-6-13(10)19(21)22/h1-9,16H,(H,18,20)/b5-3+,17-7- |
| InChIKey | BZCQFMUEWXMBHO-CZMAMTTRSA-N |
| XLogP | 3.11 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|