C20H16N4O5S2 — CID 6901733
N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6901733) has the molecular formula C20H16N4O5S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6901733 |
| Molecular Formula | C20H16N4O5S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C/C=C/c1ccccc1[N+](=O)[O-])c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H16N4O5S2/c25-20(22-21-13-5-8-15-7-1-4-11-18(15)24(26)27)16-9-2-3-10-17(16)23-31(28,29)19-12-6-14-30-19/h1-14,23H,(H,22,25)/b8-5+,21-13+ |
| InChIKey | KEXLMHGTQOUFML-QRJSFIJRSA-N |
| XLogP | 3.89 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|