C17H14N4O3S2 — CID 6908136
N-[(E)-pyridin-4-ylmethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6908136) has the molecular formula C17H14N4O3S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[(E)-pyridin-4-ylmethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-pyridin-4-ylmethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6908136 |
| Molecular Formula | C17H14N4O3S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-[(E)-pyridin-4-ylmethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C/c1ccncc1)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H14N4O3S2/c22-17(20-19-12-13-7-9-18-10-8-13)14-4-1-2-5-15(14)21-26(23,24)16-6-3-11-25-16/h1-12,21H,(H,20,22)/b19-12+ |
| InChIKey | GUXQDZBFMYGDHV-XDHOZWIPSA-N |
| XLogP | 2.71 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|