C19H18N4O5S2 — CID 2402957
N-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2402957) has the molecular formula C19H18N4O5S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2402957 |
| Molecular Formula | C19H18N4O5S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1ncc(CO)c(C=NNC(=O)c2ccccc2NS(=O)(=O)c2cccs2)c1O |
| InChI | InChI=1S/C19H18N4O5S2/c1-12-18(25)15(13(11-24)9-20-12)10-21-22-19(26)14-5-2-3-6-16(14)23-30(27,28)17-7-4-8-29-17/h2-10,23-25H,11H2,1H3,(H,22,26) |
| InChIKey | TYZSDXRBJBPRQX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|