C21H18N4O3S2 — CID 136919028
N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 136919028) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 136919028 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H18N4O3S2/c1-14-17(15-7-2-4-9-18(15)23-14)13-22-24-21(26)16-8-3-5-10-19(16)25-30(27,28)20-11-6-12-29-20/h2-13,23,25H,1H3,(H,24,26)/b22-13- |
| InChIKey | PNPLHCRSZYQHAD-XKZIYDEJSA-N |
| XLogP | 4.10 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|