C17H14N4O3 — CID 136899350
N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide (PubChem CID 136899350) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide.
| Compound Name | N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 136899350 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O3/c1-11-14(12-6-2-4-8-15(12)19-11)10-18-20-17(22)13-7-3-5-9-16(13)21(23)24/h2-10,19H,1H3,(H,20,22)/b18-10- |
| InChIKey | RWYONANQXAQLNK-ZDLGFXPLSA-N |
| XLogP | 3.15 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|