C20H16N6O3 — CID 3431156
N-[(2-methyl-1H-indol-3-yl)methylideneamino]-3-(3-nitrophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 3431156) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is N-[(2-methyl-1H-indol-3-yl)methylideneamino]-3-(3-nitrophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2-methyl-1H-indol-3-yl)methylideneamino]-3-(3-nitrophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3431156 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[(2-methyl-1H-indol-3-yl)methylideneamino]-3-(3-nitrophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C=NNC(=O)c1cc(-c2cccc([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C20H16N6O3/c1-12-16(15-7-2-3-8-17(15)22-12)11-21-25-20(27)19-10-18(23-24-19)13-5-4-6-14(9-13)26(28)29/h2-11,22H,1H3,(H,23,24)(H,25,27) |
| InChIKey | SEFHTQGGVXVVGL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|