C28H25N5O2 — CID 136915601
N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 136915601) has the molecular formula C28H25N5O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136915601 |
| Molecular Formula | C28H25N5O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)c1cc(-c2ccc(OCCc3ccccc3)cc2)n[nH]1 |
| InChI | InChI=1S/C28H25N5O2/c1-19-24(23-9-5-6-10-25(23)30-19)18-29-33-28(34)27-17-26(31-32-27)21-11-13-22(14-12-21)35-16-15-20-7-3-2-4-8-20/h2-14,17-18,30H,15-16H2,1H3,(H,31,32)(H,33,34)/b29-18- |
| InChIKey | PCAYJHBDYVWVCQ-MIXAMLLLSA-N |
| XLogP | 5.25 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|