C23H23N5O2 — CID 136762097
3-(4-butoxyphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 136762097) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-butoxyphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136762097 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-(4-butoxyphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)N/N=C\c3c[nH]c4ccccc34)[nH]n2)cc1 |
| InChI | InChI=1S/C23H23N5O2/c1-2-3-12-30-18-10-8-16(9-11-18)21-13-22(27-26-21)23(29)28-25-15-17-14-24-20-7-5-4-6-19(17)20/h4-11,13-15,24H,2-3,12H2,1H3,(H,26,27)(H,28,29)/b25-15- |
| InChIKey | IQJWYILWCGPCNW-MYYYXRDXSA-N |
| XLogP | 4.50 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|