C19H13Cl2N5O — CID 135641952
3-(3,4-dichlorophenyl)-N-[(E)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 135641952) has the molecular formula C19H13Cl2N5O and a molecular weight of 398.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[(E)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[(E)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135641952 |
| Molecular Formula | C19H13Cl2N5O |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[(E)-1H-indol-3-ylmethylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1c[nH]c2ccccc12)c1cc(-c2ccc(Cl)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C19H13Cl2N5O/c20-14-6-5-11(7-15(14)21)17-8-18(25-24-17)19(27)26-23-10-12-9-22-16-4-2-1-3-13(12)16/h1-10,22H,(H,24,25)(H,26,27)/b23-10+ |
| InChIKey | HWXQOCXYBNWXMW-AUEPDCJTSA-N |
| XLogP | 4.63 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|