C20H15Cl2N5O — CID 136915483
3-(3,4-dichlorophenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 136915483) has the molecular formula C20H15Cl2N5O and a molecular weight of 412.28 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136915483 |
| Molecular Formula | C20H15Cl2N5O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C20H15Cl2N5O/c1-11-14(13-4-2-3-5-17(13)24-11)10-23-27-20(28)19-9-18(25-26-19)12-6-7-15(21)16(22)8-12/h2-10,24H,1H3,(H,25,26)(H,27,28)/b23-10- |
| InChIKey | GCRFTDZPHSRFDY-RMORIDSASA-N |
| XLogP | 4.94 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|